C13H17FN2O — CID 114708516
6-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine (PubChem CID 114708516) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 6-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine.
| Compound Name | 6-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
|---|---|
| PubChem CID | 114708516 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
| SMILES | NC1CC2(CCNCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C13H17FN2O/c14-9-1-2-12-10(7-9)11(15)8-13(17-12)3-5-16-6-4-13/h1-2,7,11,16H,3-6,8,15H2 |
| InChIKey | INIFEGWJEIKGMK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |