C14H18FNO2 — CID 114708531
6-fluorospiro[3,4-dihydrochromene-2,4'-oxepane]-4-amine (PubChem CID 114708531) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 6-fluorospiro[3,4-dihydrochromene-2,4'-oxepane]-4-amine.
| Compound Name | 6-fluorospiro[3,4-dihydrochromene-2,4'-oxepane]-4-amine |
|---|---|
| PubChem CID | 114708531 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 6-fluorospiro[3,4-dihydrochromene-2,4'-oxepane]-4-amine |
| SMILES | NC1CC2(CCCOCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FNO2/c15-10-2-3-13-11(8-10)12(16)9-14(18-13)4-1-6-17-7-5-14/h2-3,8,12H,1,4-7,9,16H2 |
| InChIKey | NRJKDHJDPJFYSK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |