C14H19NO2 — CID 104946649
(4R)-6-methylspiro[3,4-dihydrochromene-2,3'-oxane]-4-amine (PubChem CID 104946649) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4R)-6-methylspiro[3,4-dihydrochromene-2,3'-oxane]-4-amine.
| Compound Name | (4R)-6-methylspiro[3,4-dihydrochromene-2,3'-oxane]-4-amine |
|---|---|
| PubChem CID | 104946649 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4R)-6-methylspiro[3,4-dihydrochromene-2,3'-oxane]-4-amine |
| SMILES | Cc1ccc2c(c1)[C@H](N)CC1(CCCOC1)O2 |
| InChI | InChI=1S/C14H19NO2/c1-10-3-4-13-11(7-10)12(15)8-14(17-13)5-2-6-16-9-14/h3-4,7,12H,2,5-6,8-9,15H2,1H3/t12-,14?/m1/s1 |
| InChIKey | DNLKMOIOJNBSEG-PUODRLBUSA-N |
| XLogP | 2.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |