About 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine
2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine (PubChem CID 82087172) has the molecular formula C15H20FNO
and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine |
| PubChem CID | 82087172 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine |
| SMILES | NCCC1CC2(CCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C15H20FNO/c16-12-3-4-14-13(9-12)11(5-8-17)10-15(18-14)6-1-2-7-15/h3-4,9,11H,1-2,5-8,10,17H2 |
| InChIKey | CYQHMCMAKPYZPX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine?
The IUPAC name of 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine (CID 82087172) is 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine.
What is the SMILES notation for 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine?
The canonical SMILES for 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine is NCCC1CC2(CCCC2)Oc2ccc(F)cc21.
What is the InChIKey of 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine?
The InChIKey is CYQHMCMAKPYZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO/c16-12-3-4-14-13(9-12)11(5-8-17)10-15(18-14)6-1-2-7-15/h3-4,9,11H,1-2,5-8,10,17H2.
What are the key properties of 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine?
2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine has a molecular weight of 249.33 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)ethanamine is sourced from PubChem (CID 82087172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).