C18H27FN2O — CID 82462731
N-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 82462731) has the molecular formula C18H27FN2O and a molecular weight of 306.43 g/mol. Its IUPAC name is N-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82462731 |
| Molecular Formula | C18H27FN2O |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-(6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1CC2(CCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C18H27FN2O/c1-21(2)11-5-10-20-16-13-18(8-3-4-9-18)22-17-7-6-14(19)12-15(16)17/h6-7,12,16,20H,3-5,8-11,13H2,1-2H3 |
| InChIKey | YCPBNQQCURXLDV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|