C19H29NO — CID 82462871
N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 82462871) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
| Compound Name | N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 82462871 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCCCNC1CC2(CCCCC2)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C19H29NO/c1-3-4-12-20-17-14-19(10-6-5-7-11-19)21-18-9-8-15(2)13-16(17)18/h8-9,13,17,20H,3-7,10-12,14H2,1-2H3 |
| InChIKey | GAATZXNALNCNOG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|