About N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine
N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 82462871) has the molecular formula C19H29NO
and a molecular weight of 287.45 g/mol. Its IUPAC name is N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
Molecular Properties
| Compound Name | N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| PubChem CID | 82462871 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCCCNC1CC2(CCCCC2)Oc2ccc(C)cc21 |
| InChI | InChI=1S/C19H29NO/c1-3-4-12-20-17-14-19(10-6-5-7-11-19)21-18-9-8-15(2)13-16(17)18/h8-9,13,17,20H,3-7,10-12,14H2,1-2H3 |
| InChIKey | GAATZXNALNCNOG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The IUPAC name of N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (CID 82462871) is N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
What is the SMILES notation for N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The canonical SMILES for N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine is CCCCNC1CC2(CCCCC2)Oc2ccc(C)cc21.
What is the InChIKey of N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The InChIKey is GAATZXNALNCNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO/c1-3-4-12-20-17-14-19(10-6-5-7-11-19)21-18-9-8-15(2)13-16(17)18/h8-9,13,17,20H,3-7,10-12,14H2,1-2H3.
What are the key properties of N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine has a molecular weight of 287.45 g/mol, XLogP of 4.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-methylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine is sourced from PubChem (CID 82462871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).