C18H27NO2 — CID 82462754
N-butyl-7-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (PubChem CID 82462754) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-butyl-7-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
| Compound Name | N-butyl-7-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
|---|---|
| PubChem CID | 82462754 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-butyl-7-methoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| SMILES | CCCCNC1CC2(CCCC2)Oc2cc(OC)ccc21 |
| InChI | InChI=1S/C18H27NO2/c1-3-4-11-19-16-13-18(9-5-6-10-18)21-17-12-14(20-2)7-8-15(16)17/h7-8,12,16,19H,3-6,9-11,13H2,1-2H3 |
| InChIKey | JDUUDTUZCVESJK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|