C18H26FNO — CID 82462902
N-butyl-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 82462902) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is N-butyl-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
| Compound Name | N-butyl-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 82462902 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-butyl-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCCCNC1CC2(CCCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C18H26FNO/c1-2-3-11-20-16-13-18(9-5-4-6-10-18)21-17-8-7-14(19)12-15(16)17/h7-8,12,16,20H,2-6,9-11,13H2,1H3 |
| InChIKey | YBDBQHMJHZCKLP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|