C13H17FO2 — CID 82080641
2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)ethanol (PubChem CID 82080641) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)ethanol.
| Compound Name | 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)ethanol |
|---|---|
| PubChem CID | 82080641 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)ethanol |
| SMILES | CC1(C)CC(CCO)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C13H17FO2/c1-13(2)8-9(5-6-15)11-7-10(14)3-4-12(11)16-13/h3-4,7,9,15H,5-6,8H2,1-2H3 |
| InChIKey | AXGUBXCJMFMWLO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |