C15H23FO — CID 165409856
ethane;4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 165409856) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is ethane;4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | ethane;4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 165409856 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;4-ethyl-7-fluoro-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CC.CCC1CC(C)(C)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H17FO.C2H6/c1-4-9-8-13(2,3)15-12-7-10(14)5-6-11(9)12;1-2/h5-7,9H,4,8H2,1-3H3;1-2H3 |
| InChIKey | SYOUDKCOQAQPKE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |