C14H20O — CID 163222504
(4S)-2,2-dimethyl-4-propyl-3,4-dihydrochromene (PubChem CID 163222504) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-propyl-3,4-dihydrochromene.
| Compound Name | (4S)-2,2-dimethyl-4-propyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 163222504 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (4S)-2,2-dimethyl-4-propyl-3,4-dihydrochromene |
| SMILES | CCC[C@H]1CC(C)(C)Oc2ccccc21 |
| InChI | InChI=1S/C14H20O/c1-4-7-11-10-14(2,3)15-13-9-6-5-8-12(11)13/h5-6,8-9,11H,4,7,10H2,1-3H3/t11-/m0/s1 |
| InChIKey | FMPQJDIZNJVLPK-NSHDSACASA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |