C20H26N2O — CID 88677930
1-N-[[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]methyl]-1-N'-phenylethane-1,1-diamine (PubChem CID 88677930) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-N-[[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]methyl]-1-N'-phenylethane-1,1-diamine.
| Compound Name | 1-N-[[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]methyl]-1-N'-phenylethane-1,1-diamine |
|---|---|
| PubChem CID | 88677930 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-N-[[(4R)-2,2-dimethyl-3,4-dihydrochromen-4-yl]methyl]-1-N'-phenylethane-1,1-diamine |
| SMILES | CC(NC[C@@H]1CC(C)(C)Oc2ccccc21)Nc1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-15(22-17-9-5-4-6-10-17)21-14-16-13-20(2,3)23-19-12-8-7-11-18(16)19/h4-12,15-16,21-22H,13-14H2,1-3H3/t15?,16-/m0/s1 |
| InChIKey | FVKUCTHRXZOQFR-LYKKTTPLSA-N |
| XLogP | 4.38 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|