About (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol
(2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol (PubChem CID 166881914) has the molecular formula C12H16OS
and a molecular weight of 208.33 g/mol. Its IUPAC name is (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol.
Molecular Properties
| Compound Name | (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol |
| PubChem CID | 166881914 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol |
| SMILES | CC1(C)CC(CS)c2ccccc2O1 |
| InChI | InChI=1S/C12H16OS/c1-12(2)7-9(8-14)10-5-3-4-6-11(10)13-12/h3-6,9,14H,7-8H2,1-2H3 |
| InChIKey | JHFDFOJEUKKSQA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol?
The IUPAC name of (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol (CID 166881914) is (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol.
What is the SMILES notation for (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol?
The canonical SMILES for (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol is CC1(C)CC(CS)c2ccccc2O1.
What is the InChIKey of (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol?
The InChIKey is JHFDFOJEUKKSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS/c1-12(2)7-9(8-14)10-5-3-4-6-11(10)13-12/h3-6,9,14H,7-8H2,1-2H3.
What are the key properties of (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol?
(2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol has a molecular weight of 208.33 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-3,4-dihydrochromen-4-yl)methanethiol is sourced from PubChem (CID 166881914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).