About N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine
N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 81137115) has the molecular formula C18H27NO
and a molecular weight of 273.42 g/mol. Its IUPAC name is N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 81137115 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(C)CC(NC2CCCCCC2)c2ccccc2O1 |
| InChI | InChI=1S/C18H27NO/c1-18(2)13-16(15-11-7-8-12-17(15)20-18)19-14-9-5-3-4-6-10-14/h7-8,11-12,14,16,19H,3-6,9-10,13H2,1-2H3 |
| InChIKey | ZCPYFBJBFKNNNE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine?
The IUPAC name of N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine (CID 81137115) is N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine is CC1(C)CC(NC2CCCCCC2)c2ccccc2O1.
What is the InChIKey of N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine?
The InChIKey is ZCPYFBJBFKNNNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO/c1-18(2)13-16(15-11-7-8-12-17(15)20-18)19-14-9-5-3-4-6-10-14/h7-8,11-12,14,16,19H,3-6,9-10,13H2,1-2H3.
What are the key properties of N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine?
N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine has a molecular weight of 273.42 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cycloheptyl-2,2-dimethyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 81137115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).