About 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one
5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one (PubChem CID 81140242) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one |
| PubChem CID | 81140242 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one |
| SMILES | CN1CC(NC2CC(C)(C)Oc3ccccc32)CCC1=O |
| InChI | InChI=1S/C17H24N2O2/c1-17(2)10-14(13-6-4-5-7-15(13)21-17)18-12-8-9-16(20)19(3)11-12/h4-7,12,14,18H,8-11H2,1-3H3 |
| InChIKey | YNSSOIBHLAIIBQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one (CID 81140242) is 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one is CN1CC(NC2CC(C)(C)Oc3ccccc32)CCC1=O.
What is the InChIKey of 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one?
The InChIKey is YNSSOIBHLAIIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-17(2)10-14(13-6-4-5-7-15(13)21-17)18-12-8-9-16(20)19(3)11-12/h4-7,12,14,18H,8-11H2,1-3H3.
What are the key properties of 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one?
5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one has a molecular weight of 288.39 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]-1-methylpiperidin-2-one is sourced from PubChem (CID 81140242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).