C12H17NO — CID 104945969
(4S)-2-ethyl-2-methyl-3,4-dihydrochromen-4-amine (PubChem CID 104945969) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (4S)-2-ethyl-2-methyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-2-ethyl-2-methyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104945969 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4S)-2-ethyl-2-methyl-3,4-dihydrochromen-4-amine |
| SMILES | CCC1(C)C[C@H](N)c2ccccc2O1 |
| InChI | InChI=1S/C12H17NO/c1-3-12(2)8-10(13)9-6-4-5-7-11(9)14-12/h4-7,10H,3,8,13H2,1-2H3/t10-,12?/m0/s1 |
| InChIKey | GRSLNYGHBQAPEG-NUHJPDEHSA-N |
| XLogP | 2.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |