C12H15NO — CID 95970213
(4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine (PubChem CID 95970213) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine.
| Compound Name | (4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine |
|---|---|
| PubChem CID | 95970213 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (4S)-spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-amine |
| SMILES | N[C@H]1CC2(CCC2)Oc2ccccc21 |
| InChI | InChI=1S/C12H15NO/c13-10-8-12(6-3-7-12)14-11-5-2-1-4-9(10)11/h1-2,4-5,10H,3,6-8,13H2/t10-/m0/s1 |
| InChIKey | QFQGXOGAIJYSFK-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |