About (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine
(4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (PubChem CID 42129974) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
Molecular Properties
| Compound Name | (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| PubChem CID | 42129974 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| SMILES | N[C@@H]1CC2(CCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H17NO/c14-11-9-13(7-3-4-8-13)15-12-6-2-1-5-10(11)12/h1-2,5-6,11H,3-4,7-9,14H2/t11-/m1/s1 |
| InChIKey | JLJGHWLOLDSRLO-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The IUPAC name of (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (CID 42129974) is (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
What is the SMILES notation for (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The canonical SMILES for (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine is N[C@@H]1CC2(CCCC2)Oc2ccccc21.
What is the InChIKey of (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The InChIKey is JLJGHWLOLDSRLO-LLVKDONJSA-N. The full InChI is InChI=1S/C13H17NO/c14-11-9-13(7-3-4-8-13)15-12-6-2-1-5-10(11)12/h1-2,5-6,11H,3-4,7-9,14H2/t11-/m1/s1.
What are the key properties of (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
(4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine has a molecular weight of 203.29 g/mol, XLogP of 2.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-spiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine is sourced from PubChem (CID 42129974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).