About 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine
3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 114709557) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
Molecular Properties
| Compound Name | 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| PubChem CID | 114709557 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCC1CCCC2(C1)CC(N)c1ccccc1O2 |
| InChI | InChI=1S/C16H23NO/c1-2-12-6-5-9-16(10-12)11-14(17)13-7-3-4-8-15(13)18-16/h3-4,7-8,12,14H,2,5-6,9-11,17H2,1H3 |
| InChIKey | GNWYRMYELZLHST-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The IUPAC name of 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (CID 114709557) is 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
What is the SMILES notation for 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The canonical SMILES for 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine is CCC1CCCC2(C1)CC(N)c1ccccc1O2.
What is the InChIKey of 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
The InChIKey is GNWYRMYELZLHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-2-12-6-5-9-16(10-12)11-14(17)13-7-3-4-8-15(13)18-16/h3-4,7-8,12,14H,2,5-6,9-11,17H2,1H3.
What are the key properties of 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine?
3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine has a molecular weight of 245.37 g/mol, XLogP of 3.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-ethylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine is sourced from PubChem (CID 114709557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).