C16H24N2O — CID 104946207
(4R)-1'-ethylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine (PubChem CID 104946207) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (4R)-1'-ethylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine.
| Compound Name | (4R)-1'-ethylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
|---|---|
| PubChem CID | 104946207 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (4R)-1'-ethylspiro[3,4-dihydrochromene-2,4'-azepane]-4-amine |
| SMILES | CCN1CCCC2(CC1)C[C@@H](N)c1ccccc1O2 |
| InChI | InChI=1S/C16H24N2O/c1-2-18-10-5-8-16(9-11-18)12-14(17)13-6-3-4-7-15(13)19-16/h3-4,6-7,14H,2,5,8-12,17H2,1H3/t14-,16?/m1/s1 |
| InChIKey | MHZUQARJCCBHPB-IURRXHLWSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |