About 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride
1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride (PubChem CID 43810428) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride |
| PubChem CID | 43810428 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride |
| SMILES | CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl |
| InChI | InChI=1S/C14H20N2O.ClH/c1-16-8-6-14(7-9-16)10-12(15)11-4-2-3-5-13(11)17-14;/h2-5,12H,6-10,15H2,1H3;1H |
| InChIKey | NNVNAJGCZFCILW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride?
The IUPAC name of 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride (CID 43810428) is 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride.
What is the SMILES notation for 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride?
The canonical SMILES for 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride is CN1CCC2(CC1)CC(N)c1ccccc1O2.Cl.
What is the InChIKey of 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride?
The InChIKey is NNVNAJGCZFCILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O.ClH/c1-16-8-6-14(7-9-16)10-12(15)11-4-2-3-5-13(11)17-14;/h2-5,12H,6-10,15H2,1H3;1H.
What are the key properties of 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride?
1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride has a molecular weight of 268.79 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine;hydrochloride is sourced from PubChem (CID 43810428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).