C17H25NO — CID 104946149
(4R)-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 104946149) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (4R)-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
| Compound Name | (4R)-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 104946149 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (4R)-4'-propylspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCCC1CCC2(CC1)C[C@@H](N)c1ccccc1O2 |
| InChI | InChI=1S/C17H25NO/c1-2-5-13-8-10-17(11-9-13)12-15(18)14-6-3-4-7-16(14)19-17/h3-4,6-7,13,15H,2,5,8-12,18H2,1H3/t13?,15-,17?/m1/s1 |
| InChIKey | IXEORZLFWLBZEW-GNHJJJEISA-N |
| XLogP | 4.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |