About (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine
(4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine (PubChem CID 104945926) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine |
| PubChem CID | 104945926 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(CC2CCC2)C[C@H](N)c2ccccc2O1 |
| InChI | InChI=1S/C15H21NO/c1-15(9-11-5-4-6-11)10-13(16)12-7-2-3-8-14(12)17-15/h2-3,7-8,11,13H,4-6,9-10,16H2,1H3/t13-,15?/m0/s1 |
| InChIKey | UGBBPFSDCURJSH-CFMCSPIPSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine?
The IUPAC name of (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine (CID 104945926) is (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine.
What is the SMILES notation for (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine?
The canonical SMILES for (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine is CC1(CC2CCC2)C[C@H](N)c2ccccc2O1.
What is the InChIKey of (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine?
The InChIKey is UGBBPFSDCURJSH-CFMCSPIPSA-N. The full InChI is InChI=1S/C15H21NO/c1-15(9-11-5-4-6-11)10-13(16)12-7-2-3-8-14(12)17-15/h2-3,7-8,11,13H,4-6,9-10,16H2,1H3/t13-,15?/m0/s1.
What are the key properties of (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine?
(4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine has a molecular weight of 231.34 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 104945926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).