C15H21NO — CID 104945926
(4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine (PubChem CID 104945926) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104945926 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (4S)-2-(cyclobutylmethyl)-2-methyl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(CC2CCC2)C[C@H](N)c2ccccc2O1 |
| InChI | InChI=1S/C15H21NO/c1-15(9-11-5-4-6-11)10-13(16)12-7-2-3-8-14(12)17-15/h2-3,7-8,11,13H,4-6,9-10,16H2,1H3/t13-,15?/m0/s1 |
| InChIKey | UGBBPFSDCURJSH-CFMCSPIPSA-N |
| XLogP | 3.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |