C11H15FN2OS — CID 165409875
S-[(7-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]thiohydroxylamine (PubChem CID 165409875) has the molecular formula C11H15FN2OS and a molecular weight of 242.32 g/mol. Its IUPAC name is S-[(7-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]thiohydroxylamine.
| Compound Name | S-[(7-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]thiohydroxylamine |
|---|---|
| PubChem CID | 165409875 |
| Molecular Formula | C11H15FN2OS |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | S-[(7-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl)amino]thiohydroxylamine |
| SMILES | CC1(C)CC(NSN)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C11H15FN2OS/c1-11(2)6-9(14-16-13)8-4-3-7(12)5-10(8)15-11/h3-5,9,14H,6,13H2,1-2H3 |
| InChIKey | CJXYYYWFZCECJK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|