C12H16BrNO — CID 79982958
7-bromo-N,2,2-trimethyl-3,4-dihydrochromen-4-amine (PubChem CID 79982958) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is 7-bromo-N,2,2-trimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 7-bromo-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 79982958 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 7-bromo-N,2,2-trimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CNC1CC(C)(C)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H16BrNO/c1-12(2)7-10(14-3)9-5-4-8(13)6-11(9)15-12/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | BQMOBIGRUGMJAF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |