C11H14BrNO — CID 97050676
(4S)-7-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 97050676) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is (4S)-7-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-7-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 97050676 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (4S)-7-bromo-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(C)C[C@H](N)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C11H14BrNO/c1-11(2)6-9(13)8-4-3-7(12)5-10(8)14-11/h3-5,9H,6,13H2,1-2H3/t9-/m0/s1 |
| InChIKey | CALLMQCITOKEHG-VIFPVBQESA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |