C12H17NO — CID 42220633
(4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-amine (PubChem CID 42220633) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 42220633 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-amine |
| SMILES | Cc1ccc2c(c1)OC(C)(C)C[C@@H]2N |
| InChI | InChI=1S/C12H17NO/c1-8-4-5-9-10(13)7-12(2,3)14-11(9)6-8/h4-6,10H,7,13H2,1-3H3/t10-/m0/s1 |
| InChIKey | BKAPEEZAPOLFQE-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |