C15H22O — CID 11806168
2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine (PubChem CID 11806168) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine.
| Compound Name | 2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine |
|---|---|
| PubChem CID | 11806168 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 2,2,6,9-tetramethyl-3,4,5,6-tetrahydro-1-benzoxocine |
| SMILES | Cc1ccc2c(c1)OC(C)(C)CCCC2C |
| InChI | InChI=1S/C15H22O/c1-11-7-8-13-12(2)6-5-9-15(3,4)16-14(13)10-11/h7-8,10,12H,5-6,9H2,1-4H3 |
| InChIKey | QULTWZAMEKZDET-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |