C14H22O — CID 143826176
5,8-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;ethane (PubChem CID 143826176) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 5,8-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;ethane.
| Compound Name | 5,8-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;ethane |
|---|---|
| PubChem CID | 143826176 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 5,8-dimethyl-2,3,4,5-tetrahydro-1-benzoxepine;ethane |
| SMILES | CC.Cc1ccc2c(c1)OCCCC2C |
| InChI | InChI=1S/C12H16O.C2H6/c1-9-5-6-11-10(2)4-3-7-13-12(11)8-9;1-2/h5-6,8,10H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | DJWCPEVWEHEQKL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |