C24H30N2O2S — CID 100720242
1-(4-cyclopentyloxyphenyl)-3-[(4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea (PubChem CID 100720242) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-(4-cyclopentyloxyphenyl)-3-[(4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea.
| Compound Name | 1-(4-cyclopentyloxyphenyl)-3-[(4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 100720242 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-(4-cyclopentyloxyphenyl)-3-[(4S)-2,2,7-trimethyl-3,4-dihydrochromen-4-yl]thiourea |
| SMILES | Cc1ccc2c(c1)OC(C)(C)C[C@@H]2NC(=S)Nc1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C24H30N2O2S/c1-16-8-13-20-21(15-24(2,3)28-22(20)14-16)26-23(29)25-17-9-11-19(12-10-17)27-18-6-4-5-7-18/h8-14,18,21H,4-7,15H2,1-3H3,(H2,25,26,29)/t21-/m0/s1 |
| InChIKey | YOECUKURSNLLKJ-NRFANRHFSA-N |
| XLogP | 5.91 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|