C13H19NO — CID 42220652
(4R)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-amine (PubChem CID 42220652) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (4R)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4R)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 42220652 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (4R)-2,2,6,7-tetramethyl-3,4-dihydrochromen-4-amine |
| SMILES | Cc1cc2c(cc1C)[C@H](N)CC(C)(C)O2 |
| InChI | InChI=1S/C13H19NO/c1-8-5-10-11(14)7-13(3,4)15-12(10)6-9(8)2/h5-6,11H,7,14H2,1-4H3/t11-/m1/s1 |
| InChIKey | QYFREVFIVRIKQH-LLVKDONJSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |