C13H19NO — CID 42220642
(4S)-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 42220642) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (4S)-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 42220642 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (4S)-6-ethyl-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CCc1ccc2c(c1)[C@@H](N)CC(C)(C)O2 |
| InChI | InChI=1S/C13H19NO/c1-4-9-5-6-12-10(7-9)11(14)8-13(2,3)15-12/h5-7,11H,4,8,14H2,1-3H3/t11-/m0/s1 |
| InChIKey | BARMYPFKQXQJLP-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |