C12H12BrNO — CID 162342582
7-bromo-2,2-dimethyl-3,4-dihydrochromene-4-carbonitrile (PubChem CID 162342582) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 7-bromo-2,2-dimethyl-3,4-dihydrochromene-4-carbonitrile.
| Compound Name | 7-bromo-2,2-dimethyl-3,4-dihydrochromene-4-carbonitrile |
|---|---|
| PubChem CID | 162342582 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 7-bromo-2,2-dimethyl-3,4-dihydrochromene-4-carbonitrile |
| SMILES | CC1(C)CC(C#N)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C12H12BrNO/c1-12(2)6-8(7-14)10-4-3-9(13)5-11(10)15-12/h3-5,8H,6H2,1-2H3 |
| InChIKey | RPWHQTRCSJSPIF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |