C12H12BrNOS — CID 87666640
6-bromo-4-isothiocyanato-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 87666640) has the molecular formula C12H12BrNOS and a molecular weight of 298.21 g/mol. Its IUPAC name is 6-bromo-4-isothiocyanato-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | 6-bromo-4-isothiocyanato-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 87666640 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 6-bromo-4-isothiocyanato-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CC1(C)CC(N=C=S)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C12H12BrNOS/c1-12(2)6-10(14-7-16)9-5-8(13)3-4-11(9)15-12/h3-5,10H,6H2,1-2H3 |
| InChIKey | CWQXRFVGVDBZOR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|