C12H16BrNO2 — CID 81480897
6-bromo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 81480897) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 6-bromo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 6-bromo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 81480897 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 6-bromo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CONC1CC(C)(C)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H16BrNO2/c1-12(2)7-10(14-15-3)9-6-8(13)4-5-11(9)16-12/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | FFIPMJWDZNCDJI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|