C12H16INO2 — CID 114287285
8-iodo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine (PubChem CID 114287285) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 8-iodo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine.
| Compound Name | 8-iodo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 114287285 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 8-iodo-N-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine |
| SMILES | CONC1CC(C)(C)Oc2c(I)cccc21 |
| InChI | InChI=1S/C12H16INO2/c1-12(2)7-10(14-15-3)8-5-4-6-9(13)11(8)16-12/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | ITYSHIXZTYSHEU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|