C9H10INO2 — CID 114287283
7-iodo-N-methoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 114287283) has the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. Its IUPAC name is 7-iodo-N-methoxy-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 7-iodo-N-methoxy-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 114287283 |
| Molecular Formula | C9H10INO2 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 7-iodo-N-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CONC1COc2c(I)cccc21 |
| InChI | InChI=1S/C9H10INO2/c1-12-11-8-5-13-9-6(8)3-2-4-7(9)10/h2-4,8,11H,5H2,1H3 |
| InChIKey | SLKKGXMLOIIKNW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|