C9H10FNO — CID 43511838
7-fluoro-N-methyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 43511838) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 7-fluoro-N-methyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 7-fluoro-N-methyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 43511838 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 7-fluoro-N-methyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CNC1COc2c(F)cccc21 |
| InChI | InChI=1S/C9H10FNO/c1-11-8-5-12-9-6(8)3-2-4-7(9)10/h2-4,8,11H,5H2,1H3 |
| InChIKey | WHQSMJCYQFFZPL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |