C12H16BrNO2 — CID 115402549
5-bromo-N-methoxy-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 115402549) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 5-bromo-N-methoxy-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 5-bromo-N-methoxy-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 115402549 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 5-bromo-N-methoxy-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CONC1COc2c(C(C)C)cc(Br)cc21 |
| InChI | InChI=1S/C12H16BrNO2/c1-7(2)9-4-8(13)5-10-11(14-15-3)6-16-12(9)10/h4-5,7,11,14H,6H2,1-3H3 |
| InChIKey | RXHYIOROXABJPQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|