C11H13BrO2 — CID 115403013
5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 115403013) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 115403013 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-bromo-7-propan-2-yl-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | CC(C)c1cc(Br)cc2c1OCC2O |
| InChI | InChI=1S/C11H13BrO2/c1-6(2)8-3-7(12)4-9-10(13)5-14-11(8)9/h3-4,6,10,13H,5H2,1-2H3 |
| InChIKey | CTIYSLJEWMYALK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |