C12H17BrLiN — CID 59171144
lithium [4-bromo-2,6-di(propan-2-yl)phenyl]azanide (PubChem CID 59171144) has the molecular formula C12H17BrLiN and a molecular weight of 262.12 g/mol. Its IUPAC name is lithium [4-bromo-2,6-di(propan-2-yl)phenyl]azanide.
| Compound Name | lithium [4-bromo-2,6-di(propan-2-yl)phenyl]azanide |
|---|---|
| PubChem CID | 59171144 |
| Molecular Formula | C12H17BrLiN |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | lithium [4-bromo-2,6-di(propan-2-yl)phenyl]azanide |
| SMILES | CC(C)c1cc(Br)cc(C(C)C)c1[NH-].[Li+] |
| InChI | InChI=1S/C12H17BrN.Li/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)14;/h5-8,14H,1-4H3;/q-1;+1 |
| InChIKey | ZQHODEZUNWICKJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |