C17H17BrN4 — CID 168606410
2-[4-bromo-2,6-di(propan-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168606410) has the molecular formula C17H17BrN4 and a molecular weight of 357.26 g/mol. Its IUPAC name is 2-[4-bromo-2,6-di(propan-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-bromo-2,6-di(propan-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168606410 |
| Molecular Formula | C17H17BrN4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-[4-bromo-2,6-di(propan-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC(C)c1cc(Br)cc(C(C)C)c1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C17H17BrN4/c1-10(2)14-5-13(18)6-15(11(3)4)17(14)22-16(9-21)12(7-19)8-20/h5-6,10-11,22H,1-4H3 |
| InChIKey | ITZUYSKDXHLMSY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|