C11H2Br2ClFN4 — CID 168608107
2-(2,4-dibromo-6-chloro-3-fluoroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168608107) has the molecular formula C11H2Br2ClFN4 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-chloro-3-fluoroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2,4-dibromo-6-chloro-3-fluoroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608107 |
| Molecular Formula | C11H2Br2ClFN4 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 401.83 |
| IUPAC Name | 2-(2,4-dibromo-6-chloro-3-fluoroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(Cl)cc(Br)c(F)c1Br |
| InChI | InChI=1S/C11H2Br2ClFN4/c12-6-1-7(14)11(9(13)10(6)15)19-8(4-18)5(2-16)3-17/h1,19H |
| InChIKey | PWYGDNLCLWUBHQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|