C12H3BrClN5 — CID 168608929
2-(6-bromo-2-chloro-3-cyanoanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168608929) has the molecular formula C12H3BrClN5 and a molecular weight of 332.55 g/mol. Its IUPAC name is 2-(6-bromo-2-chloro-3-cyanoanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(6-bromo-2-chloro-3-cyanoanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608929 |
| Molecular Formula | C12H3BrClN5 |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 2-(6-bromo-2-chloro-3-cyanoanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(Br)ccc(C#N)c1Cl |
| InChI | InChI=1S/C12H3BrClN5/c13-9-2-1-7(3-15)11(14)12(9)19-10(6-18)8(4-16)5-17/h1-2,19H |
| InChIKey | AHTXIUSIUAIJQE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|