C12H5N5O — CID 168609627
2-(2-cyano-6-hydroxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168609627) has the molecular formula C12H5N5O and a molecular weight of 235.21 g/mol. Its IUPAC name is 2-(2-cyano-6-hydroxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2-cyano-6-hydroxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609627 |
| Molecular Formula | C12H5N5O |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(2-cyano-6-hydroxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(O)cccc1C#N |
| InChI | InChI=1S/C12H5N5O/c13-4-8-2-1-3-11(18)12(8)17-10(7-16)9(5-14)6-15/h1-3,17-18H |
| InChIKey | LXMZSRMKFMUITR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|