C10H12N2O3 — CID 168594955
2-(2,3-dihydroxypropylamino)-3-hydroxybenzonitrile (PubChem CID 168594955) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-3-hydroxybenzonitrile.
| Compound Name | 2-(2,3-dihydroxypropylamino)-3-hydroxybenzonitrile |
|---|---|
| PubChem CID | 168594955 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-3-hydroxybenzonitrile |
| SMILES | N#Cc1cccc(O)c1NCC(O)CO |
| InChI | InChI=1S/C10H12N2O3/c11-4-7-2-1-3-9(15)10(7)12-5-8(14)6-13/h1-3,8,12-15H,5-6H2 |
| InChIKey | IPVVPLFJLHDKTK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 96.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|