C16H15ClN2O2 — CID 168594037
5-(4-chlorophenyl)-2-(2,3-dihydroxypropylamino)benzonitrile (PubChem CID 168594037) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(2,3-dihydroxypropylamino)benzonitrile.
| Compound Name | 5-(4-chlorophenyl)-2-(2,3-dihydroxypropylamino)benzonitrile |
|---|---|
| PubChem CID | 168594037 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(2,3-dihydroxypropylamino)benzonitrile |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)ccc1NCC(O)CO |
| InChI | InChI=1S/C16H15ClN2O2/c17-14-4-1-11(2-5-14)12-3-6-16(13(7-12)8-18)19-9-15(21)10-20/h1-7,15,19-21H,9-10H2 |
| InChIKey | JNXCAXJERZLQOH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |