C16H22ClN3O — CID 133337915
5-chloro-2-[[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]amino]benzonitrile (PubChem CID 133337915) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 5-chloro-2-[[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]amino]benzonitrile.
| Compound Name | 5-chloro-2-[[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]amino]benzonitrile |
|---|---|
| PubChem CID | 133337915 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 5-chloro-2-[[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]amino]benzonitrile |
| SMILES | CC1CCN(CC(O)CNc2ccc(Cl)cc2C#N)CC1 |
| InChI | InChI=1S/C16H22ClN3O/c1-12-4-6-20(7-5-12)11-15(21)10-19-16-3-2-14(17)8-13(16)9-18/h2-3,8,12,15,19,21H,4-7,10-11H2,1H3 |
| InChIKey | DXIDRCNXBCNNHT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |