C9H13ClN2O4S — CID 168597285
5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonamide (PubChem CID 168597285) has the molecular formula C9H13ClN2O4S and a molecular weight of 280.73 g/mol. Its IUPAC name is 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonamide.
| Compound Name | 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 168597285 |
| Molecular Formula | C9H13ClN2O4S |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-chloro-2-(2,3-dihydroxypropylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)ccc1NCC(O)CO |
| InChI | InChI=1S/C9H13ClN2O4S/c10-6-1-2-8(12-4-7(14)5-13)9(3-6)17(11,15)16/h1-3,7,12-14H,4-5H2,(H2,11,15,16) |
| InChIKey | AOSBYXJUFWEWBK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |