C12H18ClNO4S — CID 168597429
3-(2-chloro-5-propan-2-ylsulfonylanilino)propane-1,2-diol (PubChem CID 168597429) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is 3-(2-chloro-5-propan-2-ylsulfonylanilino)propane-1,2-diol.
| Compound Name | 3-(2-chloro-5-propan-2-ylsulfonylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168597429 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-(2-chloro-5-propan-2-ylsulfonylanilino)propane-1,2-diol |
| SMILES | CC(C)S(=O)(=O)c1ccc(Cl)c(NCC(O)CO)c1 |
| InChI | InChI=1S/C12H18ClNO4S/c1-8(2)19(17,18)10-3-4-11(13)12(5-10)14-6-9(16)7-15/h3-5,8-9,14-16H,6-7H2,1-2H3 |
| InChIKey | OJPACKWXEQGKEV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |